C19H22O8 — CID 102483102
(2R,3R,4S)-2-(3,4-dihydroxyphenyl)-4-(2-ethoxyethoxy)-3,4-dihydro-2H-chromene-3,5,7-triol (PubChem CID 102483102) has the molecular formula C19H22O8 and a molecular weight of 378.38 g/mol. Its IUPAC name is (2R,3R,4S)-2-(3,4-dihydroxyphenyl)-4-(2-ethoxyethoxy)-3,4-dihydro-2H-chromene-3,5,7-triol.
| Compound Name | (2R,3R,4S)-2-(3,4-dihydroxyphenyl)-4-(2-ethoxyethoxy)-3,4-dihydro-2H-chromene-3,5,7-triol |
|---|---|
| PubChem CID | 102483102 |
| Molecular Formula | C19H22O8 |
| Molecular Weight | 378.38 g/mol |
| Exact Mass | 378.13 |
| IUPAC Name | (2R,3R,4S)-2-(3,4-dihydroxyphenyl)-4-(2-ethoxyethoxy)-3,4-dihydro-2H-chromene-3,5,7-triol |
| SMILES | CCOCCO[C@H]1c2c(O)cc(O)cc2O[C@H](c2ccc(O)c(O)c2)[C@@H]1O |
| InChI | InChI=1S/C19H22O8/c1-2-25-5-6-26-19-16-14(23)8-11(20)9-15(16)27-18(17(19)24)10-3-4-12(21)13(22)7-10/h3-4,7-9,17-24H,2,5-6H2,1H3/t17-,18+,19-/m0/s1 |
| InChIKey | JKQXSUFCNYRCAN-OTWHNJEPSA-N |
| XLogP | 2.10 |
| TPSA | 128.84 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.38 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|