C34H37ClN2O3S — CID 102485142
2-[4-(3-chloro-6-hexoxy-1-benzothiophen-2-yl)phenyl]-5-(4-hexoxyphenyl)-1,3,4-oxadiazole (PubChem CID 102485142) has the molecular formula C34H37ClN2O3S and a molecular weight of 589.20 g/mol. Its IUPAC name is 2-[4-(3-chloro-6-hexoxy-1-benzothiophen-2-yl)phenyl]-5-(4-hexoxyphenyl)-1,3,4-oxadiazole.
| Compound Name | 2-[4-(3-chloro-6-hexoxy-1-benzothiophen-2-yl)phenyl]-5-(4-hexoxyphenyl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 102485142 |
| Molecular Formula | C34H37ClN2O3S |
| Molecular Weight | 589.20 g/mol |
| Exact Mass | 588.22 |
| IUPAC Name | 2-[4-(3-chloro-6-hexoxy-1-benzothiophen-2-yl)phenyl]-5-(4-hexoxyphenyl)-1,3,4-oxadiazole |
| SMILES | CCCCCCOc1ccc(-c2nnc(-c3ccc(-c4sc5cc(OCCCCCC)ccc5c4Cl)cc3)o2)cc1 |
| InChI | InChI=1S/C34H37ClN2O3S/c1-3-5-7-9-21-38-27-17-15-26(16-18-27)34-37-36-33(40-34)25-13-11-24(12-14-25)32-31(35)29-20-19-28(23-30(29)41-32)39-22-10-8-6-4-2/h11-20,23H,3-10,21-22H2,1-2H3 |
| InChIKey | VFRLFRDGUUZQCX-UHFFFAOYSA-N |
| XLogP | 10.86 |
| TPSA | 57.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.20 |
| LogP ≤ 5 | 10.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|