C9H19N3O2S — CID 102491850
(2S)-6-amino-2-[[(2S)-2-aminopropanethioyl]amino]hexanoic acid (PubChem CID 102491850) has the molecular formula C9H19N3O2S and a molecular weight of 233.34 g/mol. Its IUPAC name is (2S)-6-amino-2-[[(2S)-2-aminopropanethioyl]amino]hexanoic acid.
| Compound Name | (2S)-6-amino-2-[[(2S)-2-aminopropanethioyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 102491850 |
| Molecular Formula | C9H19N3O2S |
| Molecular Weight | 233.34 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | (2S)-6-amino-2-[[(2S)-2-aminopropanethioyl]amino]hexanoic acid |
| SMILES | C[C@H](N)C(=S)N[C@@H](CCCCN)C(=O)O |
| InChI | InChI=1S/C9H19N3O2S/c1-6(11)8(15)12-7(9(13)14)4-2-3-5-10/h6-7H,2-5,10-11H2,1H3,(H,12,15)(H,13,14)/t6-,7-/m0/s1 |
| InChIKey | ZLMULLYGFAMHAM-BQBZGAKWSA-N |
| XLogP | -0.17 |
| TPSA | 101.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.34 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|