C17H22O — CID 102496528
(3R,4aS,8aS)-4a,6-dimethyl-3-phenyl-1,3,4,5,8,8a-hexahydroisochromene (PubChem CID 102496528) has the molecular formula C17H22O and a molecular weight of 242.36 g/mol. Its IUPAC name is (3R,4aS,8aS)-4a,6-dimethyl-3-phenyl-1,3,4,5,8,8a-hexahydroisochromene.
| Compound Name | (3R,4aS,8aS)-4a,6-dimethyl-3-phenyl-1,3,4,5,8,8a-hexahydroisochromene |
|---|---|
| PubChem CID | 102496528 |
| Molecular Formula | C17H22O |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.17 |
| IUPAC Name | (3R,4aS,8aS)-4a,6-dimethyl-3-phenyl-1,3,4,5,8,8a-hexahydroisochromene |
| SMILES | CC1=CC[C@@H]2CO[C@@H](c3ccccc3)C[C@]2(C)C1 |
| InChI | InChI=1S/C17H22O/c1-13-8-9-15-12-18-16(11-17(15,2)10-13)14-6-4-3-5-7-14/h3-8,15-16H,9-12H2,1-2H3/t15-,16-,17+/m1/s1 |
| InChIKey | CWHLLMJICVWHOK-ZACQAIPSSA-N |
| XLogP | 4.51 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|