About 2,6-bis(4-methoxyphenyl)-4-(4-methylphenyl)-1,4-oxazine
2,6-bis(4-methoxyphenyl)-4-(4-methylphenyl)-1,4-oxazine (PubChem CID 102498198) has the molecular formula C25H23NO3
and a molecular weight of 385.46 g/mol. Its IUPAC name is 2,6-bis(4-methoxyphenyl)-4-(4-methylphenyl)-1,4-oxazine.
Molecular Properties
| Compound Name | 2,6-bis(4-methoxyphenyl)-4-(4-methylphenyl)-1,4-oxazine |
| PubChem CID | 102498198 |
| Molecular Formula | C25H23NO3 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | 2,6-bis(4-methoxyphenyl)-4-(4-methylphenyl)-1,4-oxazine |
| SMILES | COc1ccc(C2=CN(c3ccc(C)cc3)C=C(c3ccc(OC)cc3)O2)cc1 |
| InChI | InChI=1S/C25H23NO3/c1-18-4-10-21(11-5-18)26-16-24(19-6-12-22(27-2)13-7-19)29-25(17-26)20-8-14-23(28-3)15-9-20/h4-17H,1-3H3 |
| InChIKey | GLZKTBGSOGOODF-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,6-bis(4-methoxyphenyl)-4-(4-methylphenyl)-1,4-oxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-bis(4-methoxyphenyl)-4-(4-methylphenyl)-1,4-oxazine?
The IUPAC name of 2,6-bis(4-methoxyphenyl)-4-(4-methylphenyl)-1,4-oxazine (CID 102498198) is 2,6-bis(4-methoxyphenyl)-4-(4-methylphenyl)-1,4-oxazine.
What is the SMILES notation for 2,6-bis(4-methoxyphenyl)-4-(4-methylphenyl)-1,4-oxazine?
The canonical SMILES for 2,6-bis(4-methoxyphenyl)-4-(4-methylphenyl)-1,4-oxazine is COc1ccc(C2=CN(c3ccc(C)cc3)C=C(c3ccc(OC)cc3)O2)cc1.
What is the InChIKey of 2,6-bis(4-methoxyphenyl)-4-(4-methylphenyl)-1,4-oxazine?
The InChIKey is GLZKTBGSOGOODF-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H23NO3/c1-18-4-10-21(11-5-18)26-16-24(19-6-12-22(27-2)13-7-19)29-25(17-26)20-8-14-23(28-3)15-9-20/h4-17H,1-3H3.
What are the key properties of 2,6-bis(4-methoxyphenyl)-4-(4-methylphenyl)-1,4-oxazine?
2,6-bis(4-methoxyphenyl)-4-(4-methylphenyl)-1,4-oxazine has a molecular weight of 385.46 g/mol, XLogP of 5.85, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-bis(4-methoxyphenyl)-4-(4-methylphenyl)-1,4-oxazine is sourced from PubChem (CID 102498198), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).