C29H31NO5 — CID 132849157
(4R,5R)-3,6-dimethoxy-1,4,5-tris(4-methoxyphenyl)-4,5-dihydroazepine (PubChem CID 132849157) has the molecular formula C29H31NO5 and a molecular weight of 473.57 g/mol. Its IUPAC name is (4R,5R)-3,6-dimethoxy-1,4,5-tris(4-methoxyphenyl)-4,5-dihydroazepine.
| Compound Name | (4R,5R)-3,6-dimethoxy-1,4,5-tris(4-methoxyphenyl)-4,5-dihydroazepine |
|---|---|
| PubChem CID | 132849157 |
| Molecular Formula | C29H31NO5 |
| Molecular Weight | 473.57 g/mol |
| Exact Mass | 473.22 |
| IUPAC Name | (4R,5R)-3,6-dimethoxy-1,4,5-tris(4-methoxyphenyl)-4,5-dihydroazepine |
| SMILES | COC1=CN(c2ccc(OC)cc2)C=C(OC)[C@@H](c2ccc(OC)cc2)[C@@H]1c1ccc(OC)cc1 |
| InChI | InChI=1S/C29H31NO5/c1-31-23-12-6-20(7-13-23)28-26(34-4)18-30(22-10-16-25(33-3)17-11-22)19-27(35-5)29(28)21-8-14-24(32-2)15-9-21/h6-19,28-29H,1-5H3/t28-,29-/m1/s1 |
| InChIKey | KXUGLHSVWZVTBO-FQLXRVMXSA-N |
| XLogP | 6.08 |
| TPSA | 49.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.57 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |