C14H22O2 — CID 102502360
methyl (E)-3-[(3S,6S)-6-methyl-3-propan-2-ylcyclohexen-1-yl]prop-2-enoate (PubChem CID 102502360) has the molecular formula C14H22O2 and a molecular weight of 222.33 g/mol. Its IUPAC name is methyl (E)-3-[(3S,6S)-6-methyl-3-propan-2-ylcyclohexen-1-yl]prop-2-enoate.
| Compound Name | methyl (E)-3-[(3S,6S)-6-methyl-3-propan-2-ylcyclohexen-1-yl]prop-2-enoate |
|---|---|
| PubChem CID | 102502360 |
| Molecular Formula | C14H22O2 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | methyl (E)-3-[(3S,6S)-6-methyl-3-propan-2-ylcyclohexen-1-yl]prop-2-enoate |
| SMILES | COC(=O)/C=C/C1=C[C@H](C(C)C)CC[C@@H]1C |
| InChI | InChI=1S/C14H22O2/c1-10(2)12-6-5-11(3)13(9-12)7-8-14(15)16-4/h7-12H,5-6H2,1-4H3/b8-7+/t11-,12+/m0/s1 |
| InChIKey | QNISJXCTOUVUJO-ADYIUWEDSA-N |
| XLogP | 3.34 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|