C12H15NO — CID 102508373
2-(6-iminocyclohexa-2,4-dien-1-yl)cyclohexan-1-one (PubChem CID 102508373) has the molecular formula C12H15NO and a molecular weight of 189.26 g/mol. Its IUPAC name is 2-(6-iminocyclohexa-2,4-dien-1-yl)cyclohexan-1-one.
| Compound Name | 2-(6-iminocyclohexa-2,4-dien-1-yl)cyclohexan-1-one |
|---|---|
| PubChem CID | 102508373 |
| Molecular Formula | C12H15NO |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.12 |
| IUPAC Name | 2-(6-iminocyclohexa-2,4-dien-1-yl)cyclohexan-1-one |
| SMILES | [H]/N=C1\C=CC=CC1C1CCCCC1=O |
| InChI | InChI=1S/C12H15NO/c13-11-7-3-1-5-9(11)10-6-2-4-8-12(10)14/h1,3,5,7,9-10,13H,2,4,6,8H2/b13-11+ |
| InChIKey | DSVZHAODDOGZOZ-ACCUITESSA-N |
| XLogP | 2.51 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|