About 2-(7-bromo-3,4-dihydronaphthalen-1-yl)ethanol
2-(7-bromo-3,4-dihydronaphthalen-1-yl)ethanol (PubChem CID 102513348) has the molecular formula C12H13BrO
and a molecular weight of 253.14 g/mol. Its IUPAC name is 2-(7-bromo-3,4-dihydronaphthalen-1-yl)ethanol.
Molecular Properties
| Compound Name | 2-(7-bromo-3,4-dihydronaphthalen-1-yl)ethanol |
| PubChem CID | 102513348 |
| Molecular Formula | C12H13BrO |
| Molecular Weight | 253.14 g/mol |
| Exact Mass | 252.01 |
| IUPAC Name | 2-(7-bromo-3,4-dihydronaphthalen-1-yl)ethanol |
| SMILES | OCCC1=CCCc2ccc(Br)cc21 |
| InChI | InChI=1S/C12H13BrO/c13-11-5-4-9-2-1-3-10(6-7-14)12(9)8-11/h3-5,8,14H,1-2,6-7H2 |
| InChIKey | QUYDDRPWECCGPE-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.14 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(7-bromo-3,4-dihydronaphthalen-1-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(7-bromo-3,4-dihydronaphthalen-1-yl)ethanol?
The IUPAC name of 2-(7-bromo-3,4-dihydronaphthalen-1-yl)ethanol (CID 102513348) is 2-(7-bromo-3,4-dihydronaphthalen-1-yl)ethanol.
What is the SMILES notation for 2-(7-bromo-3,4-dihydronaphthalen-1-yl)ethanol?
The canonical SMILES for 2-(7-bromo-3,4-dihydronaphthalen-1-yl)ethanol is OCCC1=CCCc2ccc(Br)cc21.
What is the InChIKey of 2-(7-bromo-3,4-dihydronaphthalen-1-yl)ethanol?
The InChIKey is QUYDDRPWECCGPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13BrO/c13-11-5-4-9-2-1-3-10(6-7-14)12(9)8-11/h3-5,8,14H,1-2,6-7H2.
What are the key properties of 2-(7-bromo-3,4-dihydronaphthalen-1-yl)ethanol?
2-(7-bromo-3,4-dihydronaphthalen-1-yl)ethanol has a molecular weight of 253.14 g/mol, XLogP of 3.16, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(7-bromo-3,4-dihydronaphthalen-1-yl)ethanol is sourced from PubChem (CID 102513348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).