C23H22Cl2O3 — CID 10251383
3-(2,4-dichlorophenyl)-1,2-bis(4-methoxyphenyl)propan-1-ol (PubChem CID 10251383) has the molecular formula C23H22Cl2O3 and a molecular weight of 417.33 g/mol. Its IUPAC name is 3-(2,4-dichlorophenyl)-1,2-bis(4-methoxyphenyl)propan-1-ol.
| Compound Name | 3-(2,4-dichlorophenyl)-1,2-bis(4-methoxyphenyl)propan-1-ol |
|---|---|
| PubChem CID | 10251383 |
| Molecular Formula | C23H22Cl2O3 |
| Molecular Weight | 417.33 g/mol |
| Exact Mass | 416.09 |
| IUPAC Name | 3-(2,4-dichlorophenyl)-1,2-bis(4-methoxyphenyl)propan-1-ol |
| SMILES | COc1ccc(C(O)C(Cc2ccc(Cl)cc2Cl)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C23H22Cl2O3/c1-27-19-9-4-15(5-10-19)21(13-17-3-8-18(24)14-22(17)25)23(26)16-6-11-20(28-2)12-7-16/h3-12,14,21,23,26H,13H2,1-2H3 |
| InChIKey | HIQNGUYHXRKFKH-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.33 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |