C22H32N2O6 — CID 102518239
4,5,5-trimethyl-2-oxo-N-[6-[(4,5,5-trimethyl-2-oxofuran-3-carbonyl)amino]hexyl]furan-3-carboxamide (PubChem CID 102518239) has the molecular formula C22H32N2O6 and a molecular weight of 420.51 g/mol. Its IUPAC name is 4,5,5-trimethyl-2-oxo-N-[6-[(4,5,5-trimethyl-2-oxofuran-3-carbonyl)amino]hexyl]furan-3-carboxamide.
| Compound Name | 4,5,5-trimethyl-2-oxo-N-[6-[(4,5,5-trimethyl-2-oxofuran-3-carbonyl)amino]hexyl]furan-3-carboxamide |
|---|---|
| PubChem CID | 102518239 |
| Molecular Formula | C22H32N2O6 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.23 |
| IUPAC Name | 4,5,5-trimethyl-2-oxo-N-[6-[(4,5,5-trimethyl-2-oxofuran-3-carbonyl)amino]hexyl]furan-3-carboxamide |
| SMILES | CC1=C(C(=O)NCCCCCCNC(=O)C2=C(C)C(C)(C)OC2=O)C(=O)OC1(C)C |
| InChI | InChI=1S/C22H32N2O6/c1-13-15(19(27)29-21(13,3)4)17(25)23-11-9-7-8-10-12-24-18(26)16-14(2)22(5,6)30-20(16)28/h7-12H2,1-6H3,(H,23,25)(H,24,26) |
| InChIKey | QJQRSBLGGYREFK-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|