C22H34N4O4 — CID 71584517
2-imino-N-[6-[(2-imino-4,5,5-trimethylfuran-3-carbonyl)amino]hexyl]-4,5,5-trimethylfuran-3-carboxamide (PubChem CID 71584517) has the molecular formula C22H34N4O4 and a molecular weight of 418.54 g/mol. Its IUPAC name is 2-imino-N-[6-[(2-imino-4,5,5-trimethylfuran-3-carbonyl)amino]hexyl]-4,5,5-trimethylfuran-3-carboxamide.
| Compound Name | 2-imino-N-[6-[(2-imino-4,5,5-trimethylfuran-3-carbonyl)amino]hexyl]-4,5,5-trimethylfuran-3-carboxamide |
|---|---|
| PubChem CID | 71584517 |
| Molecular Formula | C22H34N4O4 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.26 |
| IUPAC Name | 2-imino-N-[6-[(2-imino-4,5,5-trimethylfuran-3-carbonyl)amino]hexyl]-4,5,5-trimethylfuran-3-carboxamide |
| SMILES | [H]/N=C1\OC(C)(C)C(C)=C1C(=O)NCCCCCCNC(=O)C1=C(C)C(C)(C)O/C1=N\[H] |
| InChI | InChI=1S/C22H34N4O4/c1-13-15(17(23)29-21(13,3)4)19(27)25-11-9-7-8-10-12-26-20(28)16-14(2)22(5,6)30-18(16)24/h23-24H,7-12H2,1-6H3,(H,25,27)(H,26,28)/b23-17-,24-18- |
| InChIKey | XUTRGPZQDJJGPD-BOYKQRMESA-N |
| XLogP | 2.98 |
| TPSA | 124.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|