C18H26N4O4 — CID 71584247
2-imino-N-[2-[(2-imino-4,5,5-trimethylfuran-3-carbonyl)amino]ethyl]-4,5,5-trimethylfuran-3-carboxamide (PubChem CID 71584247) has the molecular formula C18H26N4O4 and a molecular weight of 362.43 g/mol. Its IUPAC name is 2-imino-N-[2-[(2-imino-4,5,5-trimethylfuran-3-carbonyl)amino]ethyl]-4,5,5-trimethylfuran-3-carboxamide.
| Compound Name | 2-imino-N-[2-[(2-imino-4,5,5-trimethylfuran-3-carbonyl)amino]ethyl]-4,5,5-trimethylfuran-3-carboxamide |
|---|---|
| PubChem CID | 71584247 |
| Molecular Formula | C18H26N4O4 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | 2-imino-N-[2-[(2-imino-4,5,5-trimethylfuran-3-carbonyl)amino]ethyl]-4,5,5-trimethylfuran-3-carboxamide |
| SMILES | [H]/N=C1\OC(C)(C)C(C)=C1C(=O)NCCNC(=O)C1=C(C)C(C)(C)O/C1=N\[H] |
| InChI | InChI=1S/C18H26N4O4/c1-9-11(13(19)25-17(9,3)4)15(23)21-7-8-22-16(24)12-10(2)18(5,6)26-14(12)20/h19-20H,7-8H2,1-6H3,(H,21,23)(H,22,24)/b19-13-,20-14- |
| InChIKey | YHIYSQFYTHMSCA-AXPXABNXSA-N |
| XLogP | 1.42 |
| TPSA | 124.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|