C19H32O2Si2 — CID 102519221
diethyl-[(3E)-1-phenylhexa-3,5-dienoxy]-trimethylsilyloxysilane (PubChem CID 102519221) has the molecular formula C19H32O2Si2 and a molecular weight of 348.64 g/mol. Its IUPAC name is diethyl-[(3E)-1-phenylhexa-3,5-dienoxy]-trimethylsilyloxysilane.
| Compound Name | diethyl-[(3E)-1-phenylhexa-3,5-dienoxy]-trimethylsilyloxysilane |
|---|---|
| PubChem CID | 102519221 |
| Molecular Formula | C19H32O2Si2 |
| Molecular Weight | 348.64 g/mol |
| Exact Mass | 348.19 |
| IUPAC Name | diethyl-[(3E)-1-phenylhexa-3,5-dienoxy]-trimethylsilyloxysilane |
| SMILES | C=C/C=C/CC(O[Si](CC)(CC)O[Si](C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C19H32O2Si2/c1-7-10-12-17-19(18-15-13-11-14-16-18)20-23(8-2,9-3)21-22(4,5)6/h7,10-16,19H,1,8-9,17H2,2-6H3/b12-10+ |
| InChIKey | RLNMTXIFADOVJE-ZRDIBKRKSA-N |
| XLogP | 6.21 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.64 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|