C20H31NOSi — CID 10246025
(2E,4E)-N-tert-butyl-7-phenyl-7-trimethylsilyloxyhepta-2,4-dien-1-imine (PubChem CID 10246025) has the molecular formula C20H31NOSi and a molecular weight of 329.56 g/mol. Its IUPAC name is (2E,4E)-N-tert-butyl-7-phenyl-7-trimethylsilyloxyhepta-2,4-dien-1-imine.
| Compound Name | (2E,4E)-N-tert-butyl-7-phenyl-7-trimethylsilyloxyhepta-2,4-dien-1-imine |
|---|---|
| PubChem CID | 10246025 |
| Molecular Formula | C20H31NOSi |
| Molecular Weight | 329.56 g/mol |
| Exact Mass | 329.22 |
| IUPAC Name | (2E,4E)-N-tert-butyl-7-phenyl-7-trimethylsilyloxyhepta-2,4-dien-1-imine |
| SMILES | CC(C)(C)/N=C/C=C/C=C/CC(O[Si](C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C20H31NOSi/c1-20(2,3)21-17-13-8-7-12-16-19(22-23(4,5)6)18-14-10-9-11-15-18/h7-15,17,19H,16H2,1-6H3/b12-7+,13-8+,21-17+ |
| InChIKey | HGMHVHJOYFFTEJ-KSZQFQDYSA-N |
| XLogP | 5.95 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.56 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|