C22H36O3Si3 — CID 149048031
[diethyl(trimethylsilyloxy)silyl]oxy-diphenyl-propan-2-yloxysilane (PubChem CID 149048031) has the molecular formula C22H36O3Si3 and a molecular weight of 432.79 g/mol. Its IUPAC name is [diethyl(trimethylsilyloxy)silyl]oxy-diphenyl-propan-2-yloxysilane.
| Compound Name | [diethyl(trimethylsilyloxy)silyl]oxy-diphenyl-propan-2-yloxysilane |
|---|---|
| PubChem CID | 149048031 |
| Molecular Formula | C22H36O3Si3 |
| Molecular Weight | 432.79 g/mol |
| Exact Mass | 432.20 |
| IUPAC Name | [diethyl(trimethylsilyloxy)silyl]oxy-diphenyl-propan-2-yloxysilane |
| SMILES | CC[Si](CC)(O[Si](C)(C)C)O[Si](OC(C)C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H36O3Si3/c1-8-27(9-2,24-26(5,6)7)25-28(23-20(3)4,21-16-12-10-13-17-21)22-18-14-11-15-19-22/h10-20H,8-9H2,1-7H3 |
| InChIKey | QJEDKMRCCKSNIS-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.79 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|