C16H10N2OS2 — CID 102524600
2-(1,3-benzoxazol-2-ylmethyl)isoindole-1,3-dithione (PubChem CID 102524600) has the molecular formula C16H10N2OS2 and a molecular weight of 310.40 g/mol. Its IUPAC name is 2-(1,3-benzoxazol-2-ylmethyl)isoindole-1,3-dithione.
| Compound Name | 2-(1,3-benzoxazol-2-ylmethyl)isoindole-1,3-dithione |
|---|---|
| PubChem CID | 102524600 |
| Molecular Formula | C16H10N2OS2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.02 |
| IUPAC Name | 2-(1,3-benzoxazol-2-ylmethyl)isoindole-1,3-dithione |
| SMILES | S=C1c2ccccc2C(=S)N1Cc1nc2ccccc2o1 |
| InChI | InChI=1S/C16H10N2OS2/c20-15-10-5-1-2-6-11(10)16(21)18(15)9-14-17-12-7-3-4-8-13(12)19-14/h1-8H,9H2 |
| InChIKey | NQHPIGNCHUBZHP-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 29.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|