C35H31NO4 — CID 102529382
dimethyl 1,4-bis(4-methylphenyl)-6,6-diphenylpyridine-2,3-dicarboxylate (PubChem CID 102529382) has the molecular formula C35H31NO4 and a molecular weight of 529.64 g/mol. Its IUPAC name is dimethyl 1,4-bis(4-methylphenyl)-6,6-diphenylpyridine-2,3-dicarboxylate.
| Compound Name | dimethyl 1,4-bis(4-methylphenyl)-6,6-diphenylpyridine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 102529382 |
| Molecular Formula | C35H31NO4 |
| Molecular Weight | 529.64 g/mol |
| Exact Mass | 529.23 |
| IUPAC Name | dimethyl 1,4-bis(4-methylphenyl)-6,6-diphenylpyridine-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2ccc(C)cc2)C(c2ccccc2)(c2ccccc2)C=C1c1ccc(C)cc1 |
| InChI | InChI=1S/C35H31NO4/c1-24-15-19-26(20-16-24)30-23-35(27-11-7-5-8-12-27,28-13-9-6-10-14-28)36(29-21-17-25(2)18-22-29)32(34(38)40-4)31(30)33(37)39-3/h5-23H,1-4H3 |
| InChIKey | VDRGBIRRKWVZHD-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.64 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |