C26H22FNO4 — CID 102287968
dimethyl (2R,3R)-3-(4-fluorophenyl)-1,2-diphenyl-3H-pyrrole-2,5-dicarboxylate (PubChem CID 102287968) has the molecular formula C26H22FNO4 and a molecular weight of 431.46 g/mol. Its IUPAC name is dimethyl (2R,3R)-3-(4-fluorophenyl)-1,2-diphenyl-3H-pyrrole-2,5-dicarboxylate.
| Compound Name | dimethyl (2R,3R)-3-(4-fluorophenyl)-1,2-diphenyl-3H-pyrrole-2,5-dicarboxylate |
|---|---|
| PubChem CID | 102287968 |
| Molecular Formula | C26H22FNO4 |
| Molecular Weight | 431.46 g/mol |
| Exact Mass | 431.15 |
| IUPAC Name | dimethyl (2R,3R)-3-(4-fluorophenyl)-1,2-diphenyl-3H-pyrrole-2,5-dicarboxylate |
| SMILES | COC(=O)C1=C[C@H](c2ccc(F)cc2)[C@](C(=O)OC)(c2ccccc2)N1c1ccccc1 |
| InChI | InChI=1S/C26H22FNO4/c1-31-24(29)23-17-22(18-13-15-20(27)16-14-18)26(25(30)32-2,19-9-5-3-6-10-19)28(23)21-11-7-4-8-12-21/h3-17,22H,1-2H3/t22-,26+/m1/s1 |
| InChIKey | MZCHJCVQBUYTIZ-GJZUVCINSA-N |
| XLogP | 4.55 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.46 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |