C9H15N3 — CID 102538485
1,2,3,4,4a,5,6,7,8,8a-decahydroquinoxaline-2-carbonitrile (PubChem CID 102538485) has the molecular formula C9H15N3 and a molecular weight of 165.24 g/mol. Its IUPAC name is 1,2,3,4,4a,5,6,7,8,8a-decahydroquinoxaline-2-carbonitrile.
| Compound Name | 1,2,3,4,4a,5,6,7,8,8a-decahydroquinoxaline-2-carbonitrile |
|---|---|
| PubChem CID | 102538485 |
| Molecular Formula | C9H15N3 |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.13 |
| IUPAC Name | 1,2,3,4,4a,5,6,7,8,8a-decahydroquinoxaline-2-carbonitrile |
| SMILES | N#CC1CNC2CCCCC2N1 |
| InChI | InChI=1S/C9H15N3/c10-5-7-6-11-8-3-1-2-4-9(8)12-7/h7-9,11-12H,1-4,6H2 |
| InChIKey | PIZBNZNIVBPIRU-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 47.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |