C28H38N4OS — CID 10254505
1-[5-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]pentyl]-1-heptylurea (PubChem CID 10254505) has the molecular formula C28H38N4OS and a molecular weight of 478.71 g/mol. Its IUPAC name is 1-[5-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]pentyl]-1-heptylurea.
| Compound Name | 1-[5-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]pentyl]-1-heptylurea |
|---|---|
| PubChem CID | 10254505 |
| Molecular Formula | C28H38N4OS |
| Molecular Weight | 478.71 g/mol |
| Exact Mass | 478.28 |
| IUPAC Name | 1-[5-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]pentyl]-1-heptylurea |
| SMILES | CCCCCCCN(CCCCCSc1nc(-c2ccccc2)c(-c2ccccc2)[nH]1)C(N)=O |
| InChI | InChI=1S/C28H38N4OS/c1-2-3-4-5-13-20-32(27(29)33)21-14-8-15-22-34-28-30-25(23-16-9-6-10-17-23)26(31-28)24-18-11-7-12-19-24/h6-7,9-12,16-19H,2-5,8,13-15,20-22H2,1H3,(H2,29,33)(H,30,31) |
| InChIKey | BEJVKSBVSJTWHG-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.71 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|