C14H24F3NO3 — CID 102551480
tert-butyl 3-(2-methylpropoxy)-3-(trifluoromethyl)pyrrolidine-1-carboxylate (PubChem CID 102551480) has the molecular formula C14H24F3NO3 and a molecular weight of 311.34 g/mol. Its IUPAC name is tert-butyl 3-(2-methylpropoxy)-3-(trifluoromethyl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-(2-methylpropoxy)-3-(trifluoromethyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 102551480 |
| Molecular Formula | C14H24F3NO3 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | tert-butyl 3-(2-methylpropoxy)-3-(trifluoromethyl)pyrrolidine-1-carboxylate |
| SMILES | CC(C)COC1(C(F)(F)F)CCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C14H24F3NO3/c1-10(2)8-20-13(14(15,16)17)6-7-18(9-13)11(19)21-12(3,4)5/h10H,6-9H2,1-5H3 |
| InChIKey | QGONTRVMESJITG-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |