C12H20F3NO4 — CID 166517158
tert-butyl 3-(2-hydroxyethoxy)-3-(trifluoromethyl)pyrrolidine-1-carboxylate (PubChem CID 166517158) has the molecular formula C12H20F3NO4 and a molecular weight of 299.29 g/mol. Its IUPAC name is tert-butyl 3-(2-hydroxyethoxy)-3-(trifluoromethyl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-(2-hydroxyethoxy)-3-(trifluoromethyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 166517158 |
| Molecular Formula | C12H20F3NO4 |
| Molecular Weight | 299.29 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | tert-butyl 3-(2-hydroxyethoxy)-3-(trifluoromethyl)pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(OCCO)(C(F)(F)F)C1 |
| InChI | InChI=1S/C12H20F3NO4/c1-10(2,3)20-9(18)16-5-4-11(8-16,12(13,14)15)19-7-6-17/h17H,4-8H2,1-3H3 |
| InChIKey | OGPMOAXVFCTZIP-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.29 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |