C24H37Cl2NO6 — CID 10255629
(2E,4E)-N-[(2R,3S,6S,7R,9R,10S)-7,9-dichloro-6,10-dihydroxy-2-methoxy-8-oxo-1-oxaspiro[4.5]decan-3-yl]-4,6-dimethyldodeca-2,4-dienamide (PubChem CID 10255629) has the molecular formula C24H37Cl2NO6 and a molecular weight of 506.47 g/mol. Its IUPAC name is (2E,4E)-N-[(2R,3S,6S,7R,9R,10S)-7,9-dichloro-6,10-dihydroxy-2-methoxy-8-oxo-1-oxaspiro[4.5]decan-3-yl]-4,6-dimethyldodeca-2,4-dienamide.
| Compound Name | (2E,4E)-N-[(2R,3S,6S,7R,9R,10S)-7,9-dichloro-6,10-dihydroxy-2-methoxy-8-oxo-1-oxaspiro[4.5]decan-3-yl]-4,6-dimethyldodeca-2,4-dienamide |
|---|---|
| PubChem CID | 10255629 |
| Molecular Formula | C24H37Cl2NO6 |
| Molecular Weight | 506.47 g/mol |
| Exact Mass | 505.20 |
| IUPAC Name | (2E,4E)-N-[(2R,3S,6S,7R,9R,10S)-7,9-dichloro-6,10-dihydroxy-2-methoxy-8-oxo-1-oxaspiro[4.5]decan-3-yl]-4,6-dimethyldodeca-2,4-dienamide |
| SMILES | CCCCCCC(C)/C=C(C)/C=C/C(=O)N[C@H]1CC2(O[C@H]1OC)[C@H](O)[C@@H](Cl)C(=O)[C@H](Cl)[C@H]2O |
| InChI | InChI=1S/C24H37Cl2NO6/c1-5-6-7-8-9-14(2)12-15(3)10-11-17(28)27-16-13-24(33-23(16)32-4)21(30)18(25)20(29)19(26)22(24)31/h10-12,14,16,18-19,21-23,30-31H,5-9,13H2,1-4H3,(H,27,28)/b11-10+,15-12+/t14?,16-,18-,19-,21+,22+,23+/m0/s1 |
| InChIKey | CFUQAHJWAPYZID-QOCKTNANSA-N |
| XLogP | 3.23 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.47 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|