C23H34ClNO4 — CID 90729532
N-(4-chloro-5-hydroxyspiro[7-oxabicyclo[4.1.0]hept-3-ene-2,5'-oxolane]-3'-yl)-4,6-dimethyldodeca-2,4-dienamide (PubChem CID 90729532) has the molecular formula C23H34ClNO4 and a molecular weight of 423.98 g/mol. Its IUPAC name is N-(4-chloro-5-hydroxyspiro[7-oxabicyclo[4.1.0]hept-3-ene-2,5'-oxolane]-3'-yl)-4,6-dimethyldodeca-2,4-dienamide.
| Compound Name | N-(4-chloro-5-hydroxyspiro[7-oxabicyclo[4.1.0]hept-3-ene-2,5'-oxolane]-3'-yl)-4,6-dimethyldodeca-2,4-dienamide |
|---|---|
| PubChem CID | 90729532 |
| Molecular Formula | C23H34ClNO4 |
| Molecular Weight | 423.98 g/mol |
| Exact Mass | 423.22 |
| IUPAC Name | N-(4-chloro-5-hydroxyspiro[7-oxabicyclo[4.1.0]hept-3-ene-2,5'-oxolane]-3'-yl)-4,6-dimethyldodeca-2,4-dienamide |
| SMILES | CCCCCCC(C)C=C(C)C=CC(=O)NC1COC2(C=C(Cl)C(O)C3OC32)C1 |
| InChI | InChI=1S/C23H34ClNO4/c1-4-5-6-7-8-15(2)11-16(3)9-10-19(26)25-17-12-23(28-14-17)13-18(24)20(27)21-22(23)29-21/h9-11,13,15,17,20-22,27H,4-8,12,14H2,1-3H3,(H,25,26) |
| InChIKey | JKDMRKFHLYHEPP-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.98 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|