C33H53NO6 — CID 10507081
(2E,4Z)-N-(2'-decoxy-6-oxospiro[4,8-dioxatricyclo[5.1.0.03,5]octane-2,5'-oxolane]-3'-yl)-4,6-dimethyldodeca-2,4-dienamide (PubChem CID 10507081) has the molecular formula C33H53NO6 and a molecular weight of 559.79 g/mol. Its IUPAC name is (2E,4Z)-N-(2'-decoxy-6-oxospiro[4,8-dioxatricyclo[5.1.0.03,5]octane-2,5'-oxolane]-3'-yl)-4,6-dimethyldodeca-2,4-dienamide.
| Compound Name | (2E,4Z)-N-(2'-decoxy-6-oxospiro[4,8-dioxatricyclo[5.1.0.03,5]octane-2,5'-oxolane]-3'-yl)-4,6-dimethyldodeca-2,4-dienamide |
|---|---|
| PubChem CID | 10507081 |
| Molecular Formula | C33H53NO6 |
| Molecular Weight | 559.79 g/mol |
| Exact Mass | 559.39 |
| IUPAC Name | (2E,4Z)-N-(2'-decoxy-6-oxospiro[4,8-dioxatricyclo[5.1.0.03,5]octane-2,5'-oxolane]-3'-yl)-4,6-dimethyldodeca-2,4-dienamide |
| SMILES | CCCCCCCCCCOC1OC2(CC1NC(=O)/C=C/C(C)=C\C(C)CCCCCC)C1OC1C(=O)C1OC12 |
| InChI | InChI=1S/C33H53NO6/c1-5-7-9-11-12-13-14-16-20-37-32-25(22-33(40-32)30-28(38-30)27(36)29-31(33)39-29)34-26(35)19-18-24(4)21-23(3)17-15-10-8-6-2/h18-19,21,23,25,28-32H,5-17,20,22H2,1-4H3,(H,34,35)/b19-18+,24-21- |
| InChIKey | BHHKCSFWPWUMJL-YTAMRPHZSA-N |
| XLogP | 6.34 |
| TPSA | 89.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.79 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|