C31H49NO6 — CID 10816088
(2E,4Z)-4,6-dimethyl-N-(2'-octoxy-6-oxospiro[4,8-dioxatricyclo[5.1.0.03,5]octane-2,5'-oxolane]-3'-yl)dodeca-2,4-dienamide (PubChem CID 10816088) has the molecular formula C31H49NO6 and a molecular weight of 531.73 g/mol. Its IUPAC name is (2E,4Z)-4,6-dimethyl-N-(2'-octoxy-6-oxospiro[4,8-dioxatricyclo[5.1.0.03,5]octane-2,5'-oxolane]-3'-yl)dodeca-2,4-dienamide.
| Compound Name | (2E,4Z)-4,6-dimethyl-N-(2'-octoxy-6-oxospiro[4,8-dioxatricyclo[5.1.0.03,5]octane-2,5'-oxolane]-3'-yl)dodeca-2,4-dienamide |
|---|---|
| PubChem CID | 10816088 |
| Molecular Formula | C31H49NO6 |
| Molecular Weight | 531.73 g/mol |
| Exact Mass | 531.36 |
| IUPAC Name | (2E,4Z)-4,6-dimethyl-N-(2'-octoxy-6-oxospiro[4,8-dioxatricyclo[5.1.0.03,5]octane-2,5'-oxolane]-3'-yl)dodeca-2,4-dienamide |
| SMILES | CCCCCCCCOC1OC2(CC1NC(=O)/C=C/C(C)=C\C(C)CCCCCC)C1OC1C(=O)C1OC12 |
| InChI | InChI=1S/C31H49NO6/c1-5-7-9-11-12-14-18-35-30-23(20-31(38-30)28-26(36-28)25(34)27-29(31)37-27)32-24(33)17-16-22(4)19-21(3)15-13-10-8-6-2/h16-17,19,21,23,26-30H,5-15,18,20H2,1-4H3,(H,32,33)/b17-16+,22-19- |
| InChIKey | LPDKTXZXTXJIIM-LFJSVAKUSA-N |
| XLogP | 5.56 |
| TPSA | 89.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.73 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|