C27H34ClNO3SSi — CID 10255971
(3R)-3-(4-chlorophenyl)-1-[(1S,5R,7R)-10,10-dimethyl-3,3-dioxo-3lambda6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-3-[dimethyl(phenyl)silyl]propan-1-one (PubChem CID 10255971) has the molecular formula C27H34ClNO3SSi and a molecular weight of 516.18 g/mol. Its IUPAC name is (3R)-3-(4-chlorophenyl)-1-[(1S,5R,7R)-10,10-dimethyl-3,3-dioxo-3lambda6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-3-[dimethyl(phenyl)silyl]propan-1-one.
| Compound Name | (3R)-3-(4-chlorophenyl)-1-[(1S,5R,7R)-10,10-dimethyl-3,3-dioxo-3lambda6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-3-[dimethyl(phenyl)silyl]propan-1-one |
|---|---|
| PubChem CID | 10255971 |
| Molecular Formula | C27H34ClNO3SSi |
| Molecular Weight | 516.18 g/mol |
| Exact Mass | 515.17 |
| IUPAC Name | (3R)-3-(4-chlorophenyl)-1-[(1S,5R,7R)-10,10-dimethyl-3,3-dioxo-3lambda6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-3-[dimethyl(phenyl)silyl]propan-1-one |
| SMILES | CC1(C)[C@@H]2CC[C@]13CS(=O)(=O)N(C(=O)C[C@H](c1ccc(Cl)cc1)[Si](C)(C)c1ccccc1)[C@@H]3C2 |
| InChI | InChI=1S/C27H34ClNO3SSi/c1-26(2)20-14-15-27(26)18-33(31,32)29(24(27)16-20)25(30)17-23(19-10-12-21(28)13-11-19)34(3,4)22-8-6-5-7-9-22/h5-13,20,23-24H,14-18H2,1-4H3/t20-,23-,24-,27-/m1/s1 |
| InChIKey | IUFCEMJBBDEBJU-ZCIWVVNKSA-N |
| XLogP | 5.34 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.18 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|