C18H36N4O — CID 102561056
N-(1,4-diazabicyclo[2.2.2]octan-2-ylmethyl)-1-(3-ethoxypropyl)-3-methylpiperidin-4-amine (PubChem CID 102561056) has the molecular formula C18H36N4O and a molecular weight of 324.51 g/mol. Its IUPAC name is N-(1,4-diazabicyclo[2.2.2]octan-2-ylmethyl)-1-(3-ethoxypropyl)-3-methylpiperidin-4-amine.
| Compound Name | N-(1,4-diazabicyclo[2.2.2]octan-2-ylmethyl)-1-(3-ethoxypropyl)-3-methylpiperidin-4-amine |
|---|---|
| PubChem CID | 102561056 |
| Molecular Formula | C18H36N4O |
| Molecular Weight | 324.51 g/mol |
| Exact Mass | 324.29 |
| IUPAC Name | N-(1,4-diazabicyclo[2.2.2]octan-2-ylmethyl)-1-(3-ethoxypropyl)-3-methylpiperidin-4-amine |
| SMILES | CCOCCCN1CCC(NCC2CN3CCN2CC3)C(C)C1 |
| InChI | InChI=1S/C18H36N4O/c1-3-23-12-4-6-20-7-5-18(16(2)14-20)19-13-17-15-21-8-10-22(17)11-9-21/h16-19H,3-15H2,1-2H3 |
| InChIKey | FCNSHVWIKNFSSV-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 30.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.51 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|