C16H28N4O2S — CID 119887541
2-(aminomethyl)-N-[1-(3-ethoxypropyl)-3-methylpiperidin-4-yl]-1,3-thiazole-4-carboxamide (PubChem CID 119887541) has the molecular formula C16H28N4O2S and a molecular weight of 340.49 g/mol. Its IUPAC name is 2-(aminomethyl)-N-[1-(3-ethoxypropyl)-3-methylpiperidin-4-yl]-1,3-thiazole-4-carboxamide.
| Compound Name | 2-(aminomethyl)-N-[1-(3-ethoxypropyl)-3-methylpiperidin-4-yl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 119887541 |
| Molecular Formula | C16H28N4O2S |
| Molecular Weight | 340.49 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | 2-(aminomethyl)-N-[1-(3-ethoxypropyl)-3-methylpiperidin-4-yl]-1,3-thiazole-4-carboxamide |
| SMILES | CCOCCCN1CCC(NC(=O)c2csc(CN)n2)C(C)C1 |
| InChI | InChI=1S/C16H28N4O2S/c1-3-22-8-4-6-20-7-5-13(12(2)10-20)19-16(21)14-11-23-15(9-17)18-14/h11-13H,3-10,17H2,1-2H3,(H,19,21) |
| InChIKey | MVJNNMOPBZVSIA-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.49 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|