C27H31BrO6 — CID 10256481
[(1S,1'R,2'R,5R,6S,9R)-2'-(hydroxymethyl)-2'-methyl-10-methylidene-2,11-dioxospiro[3-oxatricyclo[7.2.1.01,6]dodecane-5,6'-cyclohexane]-1'-yl]methyl 4-bromobenzoate (PubChem CID 10256481) has the molecular formula C27H31BrO6 and a molecular weight of 531.44 g/mol. Its IUPAC name is [(1S,1'R,2'R,5R,6S,9R)-2'-(hydroxymethyl)-2'-methyl-10-methylidene-2,11-dioxospiro[3-oxatricyclo[7.2.1.01,6]dodecane-5,6'-cyclohexane]-1'-yl]methyl 4-bromobenzoate.
| Compound Name | [(1S,1'R,2'R,5R,6S,9R)-2'-(hydroxymethyl)-2'-methyl-10-methylidene-2,11-dioxospiro[3-oxatricyclo[7.2.1.01,6]dodecane-5,6'-cyclohexane]-1'-yl]methyl 4-bromobenzoate |
|---|---|
| PubChem CID | 10256481 |
| Molecular Formula | C27H31BrO6 |
| Molecular Weight | 531.44 g/mol |
| Exact Mass | 530.13 |
| IUPAC Name | [(1S,1'R,2'R,5R,6S,9R)-2'-(hydroxymethyl)-2'-methyl-10-methylidene-2,11-dioxospiro[3-oxatricyclo[7.2.1.01,6]dodecane-5,6'-cyclohexane]-1'-yl]methyl 4-bromobenzoate |
| SMILES | C=C1C(=O)[C@]23C[C@H]1CC[C@H]2[C@@]1(CCC[C@@](C)(CO)[C@H]1COC(=O)c1ccc(Br)cc1)COC3=O |
| InChI | InChI=1S/C27H31BrO6/c1-16-18-6-9-20-26(15-34-24(32)27(20,12-18)22(16)30)11-3-10-25(2,14-29)21(26)13-33-23(31)17-4-7-19(28)8-5-17/h4-5,7-8,18,20-21,29H,1,3,6,9-15H2,2H3/t18-,20+,21-,25+,26-,27+/m1/s1 |
| InChIKey | MRRDGEQXVPKXJC-VYUMPESGSA-N |
| XLogP | 4.49 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.44 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|