C30H26F3O5P — CID 10257086
dimethyl (Z)-2-[(Z)-1,1,1-trifluoro-4-oxopent-2-en-2-yl]-4-(triphenyl-lambda5-phosphanylidene)pent-2-enedioate (PubChem CID 10257086) has the molecular formula C30H26F3O5P and a molecular weight of 554.50 g/mol. Its IUPAC name is dimethyl (Z)-2-[(Z)-1,1,1-trifluoro-4-oxopent-2-en-2-yl]-4-(triphenyl-lambda5-phosphanylidene)pent-2-enedioate.
| Compound Name | dimethyl (Z)-2-[(Z)-1,1,1-trifluoro-4-oxopent-2-en-2-yl]-4-(triphenyl-lambda5-phosphanylidene)pent-2-enedioate |
|---|---|
| PubChem CID | 10257086 |
| Molecular Formula | C30H26F3O5P |
| Molecular Weight | 554.50 g/mol |
| Exact Mass | 554.15 |
| IUPAC Name | dimethyl (Z)-2-[(Z)-1,1,1-trifluoro-4-oxopent-2-en-2-yl]-4-(triphenyl-lambda5-phosphanylidene)pent-2-enedioate |
| SMILES | COC(=O)C(/C=C(C(=O)OC)/C(=C/C(C)=O)C(F)(F)F)=P(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H26F3O5P/c1-21(34)19-26(30(31,32)33)25(28(35)37-2)20-27(29(36)38-3)39(22-13-7-4-8-14-22,23-15-9-5-10-16-23)24-17-11-6-12-18-24/h4-20H,1-3H3/b25-20-,26-19- |
| InChIKey | XDJBNMPQRGZIEH-VLHFJFBNSA-N |
| XLogP | 4.50 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.50 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|