C28H22O11 — CID 102571925
8-hydroxy-4,6-bis[(2R,3R)-3,5,7-trihydroxy-3,4-dihydro-2H-chromen-2-yl]naphthalene-1,2-dione (PubChem CID 102571925) has the molecular formula C28H22O11 and a molecular weight of 534.47 g/mol. Its IUPAC name is 8-hydroxy-4,6-bis[(2R,3R)-3,5,7-trihydroxy-3,4-dihydro-2H-chromen-2-yl]naphthalene-1,2-dione.
| Compound Name | 8-hydroxy-4,6-bis[(2R,3R)-3,5,7-trihydroxy-3,4-dihydro-2H-chromen-2-yl]naphthalene-1,2-dione |
|---|---|
| PubChem CID | 102571925 |
| Molecular Formula | C28H22O11 |
| Molecular Weight | 534.47 g/mol |
| Exact Mass | 534.12 |
| IUPAC Name | 8-hydroxy-4,6-bis[(2R,3R)-3,5,7-trihydroxy-3,4-dihydro-2H-chromen-2-yl]naphthalene-1,2-dione |
| SMILES | O=C1C=C([C@H]2Oc3cc(O)cc(O)c3C[C@H]2O)c2cc([C@H]3Oc4cc(O)cc(O)c4C[C@H]3O)cc(O)c2C1=O |
| InChI | InChI=1S/C28H22O11/c29-11-3-17(31)15-8-21(35)27(38-23(15)5-11)10-1-13-14(7-20(34)26(37)25(13)19(33)2-10)28-22(36)9-16-18(32)4-12(30)6-24(16)39-28/h1-7,21-22,27-33,35-36H,8-9H2/t21-,22-,27-,28-/m1/s1 |
| InChIKey | GWOPGSNHEXOQEQ-TUJIQRHUSA-N |
| XLogP | 1.77 |
| TPSA | 194.21 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.47 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|