C14H32O6Si2 — CID 102572959
trimethoxy-[2-[(1R,3S)-3-trimethoxysilylcyclohexyl]ethyl]silane (PubChem CID 102572959) has the molecular formula C14H32O6Si2 and a molecular weight of 352.58 g/mol. Its IUPAC name is trimethoxy-[2-[(1R,3S)-3-trimethoxysilylcyclohexyl]ethyl]silane.
| Compound Name | trimethoxy-[2-[(1R,3S)-3-trimethoxysilylcyclohexyl]ethyl]silane |
|---|---|
| PubChem CID | 102572959 |
| Molecular Formula | C14H32O6Si2 |
| Molecular Weight | 352.58 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | trimethoxy-[2-[(1R,3S)-3-trimethoxysilylcyclohexyl]ethyl]silane |
| SMILES | CO[Si](CC[C@H]1CCC[C@H]([Si](OC)(OC)OC)C1)(OC)OC |
| InChI | InChI=1S/C14H32O6Si2/c1-15-21(16-2,17-3)11-10-13-8-7-9-14(12-13)22(18-4,19-5)20-6/h13-14H,7-12H2,1-6H3/t13-,14+/m1/s1 |
| InChIKey | SJTMWSNRXBMRNQ-KGLIPLIRSA-N |
| XLogP | 2.69 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.58 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|