C18H21BrO4S — CID 102573436
5-[(1R,2S)-2-(2-bromophenyl)sulfanylcyclohexyl]-2,2-dimethyl-1,3-dioxane-4,6-dione (PubChem CID 102573436) has the molecular formula C18H21BrO4S and a molecular weight of 413.33 g/mol. Its IUPAC name is 5-[(1R,2S)-2-(2-bromophenyl)sulfanylcyclohexyl]-2,2-dimethyl-1,3-dioxane-4,6-dione.
| Compound Name | 5-[(1R,2S)-2-(2-bromophenyl)sulfanylcyclohexyl]-2,2-dimethyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 102573436 |
| Molecular Formula | C18H21BrO4S |
| Molecular Weight | 413.33 g/mol |
| Exact Mass | 412.03 |
| IUPAC Name | 5-[(1R,2S)-2-(2-bromophenyl)sulfanylcyclohexyl]-2,2-dimethyl-1,3-dioxane-4,6-dione |
| SMILES | CC1(C)OC(=O)C([C@H]2CCCC[C@@H]2Sc2ccccc2Br)C(=O)O1 |
| InChI | InChI=1S/C18H21BrO4S/c1-18(2)22-16(20)15(17(21)23-18)11-7-3-5-9-13(11)24-14-10-6-4-8-12(14)19/h4,6,8,10-11,13,15H,3,5,7,9H2,1-2H3/t11-,13-/m0/s1 |
| InChIKey | GFSHADWTMNNQIZ-AAEUAGOBSA-N |
| XLogP | 4.55 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.33 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|