C19H24O4S — CID 25213165
2,2-dimethyl-5-[1-(2-methylsulfanylphenyl)cyclohexyl]-1,3-dioxane-4,6-dione (PubChem CID 25213165) has the molecular formula C19H24O4S and a molecular weight of 348.46 g/mol. Its IUPAC name is 2,2-dimethyl-5-[1-(2-methylsulfanylphenyl)cyclohexyl]-1,3-dioxane-4,6-dione.
| Compound Name | 2,2-dimethyl-5-[1-(2-methylsulfanylphenyl)cyclohexyl]-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 25213165 |
| Molecular Formula | C19H24O4S |
| Molecular Weight | 348.46 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | 2,2-dimethyl-5-[1-(2-methylsulfanylphenyl)cyclohexyl]-1,3-dioxane-4,6-dione |
| SMILES | CSc1ccccc1C1(C2C(=O)OC(C)(C)OC2=O)CCCCC1 |
| InChI | InChI=1S/C19H24O4S/c1-18(2)22-16(20)15(17(21)23-18)19(11-7-4-8-12-19)13-9-5-6-10-14(13)24-3/h5-6,9-10,15H,4,7-8,11-12H2,1-3H3 |
| InChIKey | ZHANTAGADXZHEH-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.46 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|