C20H26O4 — CID 11163325
5-[1-(3,5-dimethylphenyl)cyclohexyl]-2,2-dimethyl-1,3-dioxane-4,6-dione (PubChem CID 11163325) has the molecular formula C20H26O4 and a molecular weight of 330.42 g/mol. Its IUPAC name is 5-[1-(3,5-dimethylphenyl)cyclohexyl]-2,2-dimethyl-1,3-dioxane-4,6-dione.
| Compound Name | 5-[1-(3,5-dimethylphenyl)cyclohexyl]-2,2-dimethyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 11163325 |
| Molecular Formula | C20H26O4 |
| Molecular Weight | 330.42 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | 5-[1-(3,5-dimethylphenyl)cyclohexyl]-2,2-dimethyl-1,3-dioxane-4,6-dione |
| SMILES | Cc1cc(C)cc(C2(C3C(=O)OC(C)(C)OC3=O)CCCCC2)c1 |
| InChI | InChI=1S/C20H26O4/c1-13-10-14(2)12-15(11-13)20(8-6-5-7-9-20)16-17(21)23-19(3,4)24-18(16)22/h10-12,16H,5-9H2,1-4H3 |
| InChIKey | HPUWGUATMPHPHF-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.42 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|