C14H17NO2S — CID 102574055
1-(4-methylphenyl)sulfonyl-3,3a,6,6a-tetrahydro-2H-cyclopenta[b]pyrrole (PubChem CID 102574055) has the molecular formula C14H17NO2S and a molecular weight of 263.36 g/mol. Its IUPAC name is 1-(4-methylphenyl)sulfonyl-3,3a,6,6a-tetrahydro-2H-cyclopenta[b]pyrrole.
| Compound Name | 1-(4-methylphenyl)sulfonyl-3,3a,6,6a-tetrahydro-2H-cyclopenta[b]pyrrole |
|---|---|
| PubChem CID | 102574055 |
| Molecular Formula | C14H17NO2S |
| Molecular Weight | 263.36 g/mol |
| Exact Mass | 263.10 |
| IUPAC Name | 1-(4-methylphenyl)sulfonyl-3,3a,6,6a-tetrahydro-2H-cyclopenta[b]pyrrole |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC3C=CCC32)cc1 |
| InChI | InChI=1S/C14H17NO2S/c1-11-5-7-13(8-6-11)18(16,17)15-10-9-12-3-2-4-14(12)15/h2-3,5-8,12,14H,4,9-10H2,1H3 |
| InChIKey | ZUKUCOWZWANSSS-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.36 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|