C13H16O8 — CID 102577210
trimethyl 2-ethoxy-2H-pyran-3,5,6-tricarboxylate (PubChem CID 102577210) has the molecular formula C13H16O8 and a molecular weight of 300.26 g/mol. Its IUPAC name is trimethyl 2-ethoxy-2H-pyran-3,5,6-tricarboxylate.
| Compound Name | trimethyl 2-ethoxy-2H-pyran-3,5,6-tricarboxylate |
|---|---|
| PubChem CID | 102577210 |
| Molecular Formula | C13H16O8 |
| Molecular Weight | 300.26 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | trimethyl 2-ethoxy-2H-pyran-3,5,6-tricarboxylate |
| SMILES | CCOC1OC(C(=O)OC)=C(C(=O)OC)C=C1C(=O)OC |
| InChI | InChI=1S/C13H16O8/c1-5-20-13-8(11(15)18-3)6-7(10(14)17-2)9(21-13)12(16)19-4/h6,13H,5H2,1-4H3 |
| InChIKey | OPWTVIVJFVHPJW-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.26 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|