C19H27NO3S — CID 102578633
(3Z)-3-(1-hexylsulfonylpentylidene)-1H-indol-2-one (PubChem CID 102578633) has the molecular formula C19H27NO3S and a molecular weight of 349.50 g/mol. Its IUPAC name is (3Z)-3-(1-hexylsulfonylpentylidene)-1H-indol-2-one.
| Compound Name | (3Z)-3-(1-hexylsulfonylpentylidene)-1H-indol-2-one |
|---|---|
| PubChem CID | 102578633 |
| Molecular Formula | C19H27NO3S |
| Molecular Weight | 349.50 g/mol |
| Exact Mass | 349.17 |
| IUPAC Name | (3Z)-3-(1-hexylsulfonylpentylidene)-1H-indol-2-one |
| SMILES | CCCCCCS(=O)(=O)/C(CCCC)=C1\C(=O)Nc2ccccc21 |
| InChI | InChI=1S/C19H27NO3S/c1-3-5-7-10-14-24(22,23)17(13-6-4-2)18-15-11-8-9-12-16(15)20-19(18)21/h8-9,11-12H,3-7,10,13-14H2,1-2H3,(H,20,21)/b18-17- |
| InChIKey | KUIUDHPDQDNONN-ZCXUNETKSA-N |
| XLogP | 4.54 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.50 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|