C16H21N3O2 — CID 102579581
9-pentoxy-2,5,6,7-tetrahydro-[1,2,4]triazolo[3,4-a][2]benzazepin-3-one (PubChem CID 102579581) has the molecular formula C16H21N3O2 and a molecular weight of 287.36 g/mol. Its IUPAC name is 9-pentoxy-2,5,6,7-tetrahydro-[1,2,4]triazolo[3,4-a][2]benzazepin-3-one.
| Compound Name | 9-pentoxy-2,5,6,7-tetrahydro-[1,2,4]triazolo[3,4-a][2]benzazepin-3-one |
|---|---|
| PubChem CID | 102579581 |
| Molecular Formula | C16H21N3O2 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | 9-pentoxy-2,5,6,7-tetrahydro-[1,2,4]triazolo[3,4-a][2]benzazepin-3-one |
| SMILES | CCCCCOc1ccc2c(c1)CCCn1c-2n[nH]c1=O |
| InChI | InChI=1S/C16H21N3O2/c1-2-3-4-10-21-13-7-8-14-12(11-13)6-5-9-19-15(14)17-18-16(19)20/h7-8,11H,2-6,9-10H2,1H3,(H,18,20) |
| InChIKey | QVLFKABLJXNKLM-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 59.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|