C21H30N6O6 — CID 102587720
2-[[(2S)-6-amino-2-[[(2S)-2-[(2-aminooxyacetyl)amino]-3-(1H-indol-3-yl)propanoyl]amino]hexanoyl]amino]acetic acid (PubChem CID 102587720) has the molecular formula C21H30N6O6 and a molecular weight of 462.51 g/mol. Its IUPAC name is 2-[[(2S)-6-amino-2-[[(2S)-2-[(2-aminooxyacetyl)amino]-3-(1H-indol-3-yl)propanoyl]amino]hexanoyl]amino]acetic acid.
| Compound Name | 2-[[(2S)-6-amino-2-[[(2S)-2-[(2-aminooxyacetyl)amino]-3-(1H-indol-3-yl)propanoyl]amino]hexanoyl]amino]acetic acid |
|---|---|
| PubChem CID | 102587720 |
| Molecular Formula | C21H30N6O6 |
| Molecular Weight | 462.51 g/mol |
| Exact Mass | 462.22 |
| IUPAC Name | 2-[[(2S)-6-amino-2-[[(2S)-2-[(2-aminooxyacetyl)amino]-3-(1H-indol-3-yl)propanoyl]amino]hexanoyl]amino]acetic acid |
| SMILES | NCCCC[C@H](NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)CON)C(=O)NCC(=O)O |
| InChI | InChI=1S/C21H30N6O6/c22-8-4-3-7-16(20(31)25-11-19(29)30)27-21(32)17(26-18(28)12-33-23)9-13-10-24-15-6-2-1-5-14(13)15/h1-2,5-6,10,16-17,24H,3-4,7-9,11-12,22-23H2,(H,25,31)(H,26,28)(H,27,32)(H,29,30)/t16-,17-/m0/s1 |
| InChIKey | SZDYZUGHNDWGLD-IRXDYDNUSA-N |
| XLogP | -1.10 |
| TPSA | 201.66 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.51 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|