C23H32N6O7 — CID 18251238
3-amino-4-[[6-amino-1-[[1-(carboxymethylamino)-3-(1H-indol-3-yl)-1-oxopropan-2-yl]amino]-1-oxohexan-2-yl]amino]-4-oxobutanoic acid (PubChem CID 18251238) has the molecular formula C23H32N6O7 and a molecular weight of 504.54 g/mol. Its IUPAC name is 3-amino-4-[[6-amino-1-[[1-(carboxymethylamino)-3-(1H-indol-3-yl)-1-oxopropan-2-yl]amino]-1-oxohexan-2-yl]amino]-4-oxobutanoic acid.
| Compound Name | 3-amino-4-[[6-amino-1-[[1-(carboxymethylamino)-3-(1H-indol-3-yl)-1-oxopropan-2-yl]amino]-1-oxohexan-2-yl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 18251238 |
| Molecular Formula | C23H32N6O7 |
| Molecular Weight | 504.54 g/mol |
| Exact Mass | 504.23 |
| IUPAC Name | 3-amino-4-[[6-amino-1-[[1-(carboxymethylamino)-3-(1H-indol-3-yl)-1-oxopropan-2-yl]amino]-1-oxohexan-2-yl]amino]-4-oxobutanoic acid |
| SMILES | NCCCCC(NC(=O)C(N)CC(=O)O)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)NCC(=O)O |
| InChI | InChI=1S/C23H32N6O7/c24-8-4-3-7-17(28-21(34)15(25)10-19(30)31)23(36)29-18(22(35)27-12-20(32)33)9-13-11-26-16-6-2-1-5-14(13)16/h1-2,5-6,11,15,17-18,26H,3-4,7-10,12,24-25H2,(H,27,35)(H,28,34)(H,29,36)(H,30,31)(H,32,33) |
| InChIKey | KRUTVVKNJRYNJM-UHFFFAOYSA-N |
| XLogP | -1.19 |
| TPSA | 229.73 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.54 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|