C24H34N6O7 — CID 18304636
5-[[1-(carboxymethylamino)-3-(1H-indol-3-yl)-1-oxopropan-2-yl]amino]-4-(2,6-diaminohexanoylamino)-5-oxopentanoic acid (PubChem CID 18304636) has the molecular formula C24H34N6O7 and a molecular weight of 518.57 g/mol. Its IUPAC name is 5-[[1-(carboxymethylamino)-3-(1H-indol-3-yl)-1-oxopropan-2-yl]amino]-4-(2,6-diaminohexanoylamino)-5-oxopentanoic acid.
| Compound Name | 5-[[1-(carboxymethylamino)-3-(1H-indol-3-yl)-1-oxopropan-2-yl]amino]-4-(2,6-diaminohexanoylamino)-5-oxopentanoic acid |
|---|---|
| PubChem CID | 18304636 |
| Molecular Formula | C24H34N6O7 |
| Molecular Weight | 518.57 g/mol |
| Exact Mass | 518.25 |
| IUPAC Name | 5-[[1-(carboxymethylamino)-3-(1H-indol-3-yl)-1-oxopropan-2-yl]amino]-4-(2,6-diaminohexanoylamino)-5-oxopentanoic acid |
| SMILES | NCCCCC(N)C(=O)NC(CCC(=O)O)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)NCC(=O)O |
| InChI | InChI=1S/C24H34N6O7/c25-10-4-3-6-16(26)22(35)29-18(8-9-20(31)32)24(37)30-19(23(36)28-13-21(33)34)11-14-12-27-17-7-2-1-5-15(14)17/h1-2,5,7,12,16,18-19,27H,3-4,6,8-11,13,25-26H2,(H,28,36)(H,29,35)(H,30,37)(H,31,32)(H,33,34) |
| InChIKey | ZTPMTMCPCUXYGG-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 229.73 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.57 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|