C22H32N6O5S — CID 18257512
2-[[6-amino-2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]acetyl]amino]hexanoyl]amino]-3-(1H-indol-3-yl)propanoic acid (PubChem CID 18257512) has the molecular formula C22H32N6O5S and a molecular weight of 492.60 g/mol. Its IUPAC name is 2-[[6-amino-2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]acetyl]amino]hexanoyl]amino]-3-(1H-indol-3-yl)propanoic acid.
| Compound Name | 2-[[6-amino-2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]acetyl]amino]hexanoyl]amino]-3-(1H-indol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 18257512 |
| Molecular Formula | C22H32N6O5S |
| Molecular Weight | 492.60 g/mol |
| Exact Mass | 492.22 |
| IUPAC Name | 2-[[6-amino-2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]acetyl]amino]hexanoyl]amino]-3-(1H-indol-3-yl)propanoic acid |
| SMILES | NCCCCC(NC(=O)CNC(=O)C(N)CS)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C22H32N6O5S/c23-8-4-3-7-17(27-19(29)11-26-20(30)15(24)12-34)21(31)28-18(22(32)33)9-13-10-25-16-6-2-1-5-14(13)16/h1-2,5-6,10,15,17-18,25,34H,3-4,7-9,11-12,23-24H2,(H,26,30)(H,27,29)(H,28,31)(H,32,33) |
| InChIKey | IPWGHHABGXOKLE-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 192.43 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.60 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|