About 1,4-dibromo-2,5-bis(1-ethoxyheptyl)benzene
1,4-dibromo-2,5-bis(1-ethoxyheptyl)benzene (PubChem CID 102588788) has the molecular formula C24H40Br2O2
and a molecular weight of 520.39 g/mol. Its IUPAC name is 1,4-dibromo-2,5-bis(1-ethoxyheptyl)benzene.
Molecular Properties
| Compound Name | 1,4-dibromo-2,5-bis(1-ethoxyheptyl)benzene |
| PubChem CID | 102588788 |
| Molecular Formula | C24H40Br2O2 |
| Molecular Weight | 520.39 g/mol |
| Exact Mass | 518.14 |
| IUPAC Name | 1,4-dibromo-2,5-bis(1-ethoxyheptyl)benzene |
| SMILES | CCCCCCC(OCC)c1cc(Br)c(C(CCCCCC)OCC)cc1Br |
| InChI | InChI=1S/C24H40Br2O2/c1-5-9-11-13-15-23(27-7-3)19-17-22(26)20(18-21(19)25)24(28-8-4)16-14-12-10-6-2/h17-18,23-24H,5-16H2,1-4H3 |
| InChIKey | LUHZRYPHANVGLA-UHFFFAOYSA-N |
| XLogP | 9.31 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 520.39 |
| LogP ≤ 5 | 9.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1,4-dibromo-2,5-bis(1-ethoxyheptyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-dibromo-2,5-bis(1-ethoxyheptyl)benzene?
The IUPAC name of 1,4-dibromo-2,5-bis(1-ethoxyheptyl)benzene (CID 102588788) is 1,4-dibromo-2,5-bis(1-ethoxyheptyl)benzene.
What is the SMILES notation for 1,4-dibromo-2,5-bis(1-ethoxyheptyl)benzene?
The canonical SMILES for 1,4-dibromo-2,5-bis(1-ethoxyheptyl)benzene is CCCCCCC(OCC)c1cc(Br)c(C(CCCCCC)OCC)cc1Br.
What is the InChIKey of 1,4-dibromo-2,5-bis(1-ethoxyheptyl)benzene?
The InChIKey is LUHZRYPHANVGLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H40Br2O2/c1-5-9-11-13-15-23(27-7-3)19-17-22(26)20(18-21(19)25)24(28-8-4)16-14-12-10-6-2/h17-18,23-24H,5-16H2,1-4H3.
What are the key properties of 1,4-dibromo-2,5-bis(1-ethoxyheptyl)benzene?
1,4-dibromo-2,5-bis(1-ethoxyheptyl)benzene has a molecular weight of 520.39 g/mol, XLogP of 9.31, 16 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dibromo-2,5-bis(1-ethoxyheptyl)benzene is sourced from PubChem (CID 102588788), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).