C24H40Br2O2 — CID 102588788
1,4-dibromo-2,5-bis(1-ethoxyheptyl)benzene (PubChem CID 102588788) has the molecular formula C24H40Br2O2 and a molecular weight of 520.39 g/mol. Its IUPAC name is 1,4-dibromo-2,5-bis(1-ethoxyheptyl)benzene.
| Compound Name | 1,4-dibromo-2,5-bis(1-ethoxyheptyl)benzene |
|---|---|
| PubChem CID | 102588788 |
| Molecular Formula | C24H40Br2O2 |
| Molecular Weight | 520.39 g/mol |
| Exact Mass | 518.14 |
| IUPAC Name | 1,4-dibromo-2,5-bis(1-ethoxyheptyl)benzene |
| SMILES | CCCCCCC(OCC)c1cc(Br)c(C(CCCCCC)OCC)cc1Br |
| InChI | InChI=1S/C24H40Br2O2/c1-5-9-11-13-15-23(27-7-3)19-17-22(26)20(18-21(19)25)24(28-8-4)16-14-12-10-6-2/h17-18,23-24H,5-16H2,1-4H3 |
| InChIKey | LUHZRYPHANVGLA-UHFFFAOYSA-N |
| XLogP | 9.31 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.39 |
| LogP ≤ 5 | 9.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|