C33H52N8O7 — CID 10258950
octyl 2-[(5S,11S,14R)-11-[3-(diaminomethylideneamino)propyl]-14-ethyl-12-methyl-4,7,10,13,16-pentaoxo-3,6,9,12,15-pentazabicyclo[15.3.1]henicosa-1(21),17,19-trien-5-yl]acetate (PubChem CID 10258950) has the molecular formula C33H52N8O7 and a molecular weight of 672.83 g/mol. Its IUPAC name is octyl 2-[(5S,11S,14R)-11-[3-(diaminomethylideneamino)propyl]-14-ethyl-12-methyl-4,7,10,13,16-pentaoxo-3,6,9,12,15-pentazabicyclo[15.3.1]henicosa-1(21),17,19-trien-5-yl]acetate.
| Compound Name | octyl 2-[(5S,11S,14R)-11-[3-(diaminomethylideneamino)propyl]-14-ethyl-12-methyl-4,7,10,13,16-pentaoxo-3,6,9,12,15-pentazabicyclo[15.3.1]henicosa-1(21),17,19-trien-5-yl]acetate |
|---|---|
| PubChem CID | 10258950 |
| Molecular Formula | C33H52N8O7 |
| Molecular Weight | 672.83 g/mol |
| Exact Mass | 672.40 |
| IUPAC Name | octyl 2-[(5S,11S,14R)-11-[3-(diaminomethylideneamino)propyl]-14-ethyl-12-methyl-4,7,10,13,16-pentaoxo-3,6,9,12,15-pentazabicyclo[15.3.1]henicosa-1(21),17,19-trien-5-yl]acetate |
| SMILES | CCCCCCCCOC(=O)C[C@@H]1NC(=O)CNC(=O)[C@H](CCCN=C(N)N)N(C)C(=O)[C@@H](CC)NC(=O)c2cccc(c2)CNC1=O |
| InChI | InChI=1S/C33H52N8O7/c1-4-6-7-8-9-10-17-48-28(43)19-25-30(45)37-20-22-13-11-14-23(18-22)29(44)40-24(5-2)32(47)41(3)26(15-12-16-36-33(34)35)31(46)38-21-27(42)39-25/h11,13-14,18,24-26H,4-10,12,15-17,19-21H2,1-3H3,(H,37,45)(H,38,46)(H,39,42)(H,40,44)(H4,34,35,36)/t24-,25+,26+/m1/s1 |
| InChIKey | GHSVBTPFDXOKEP-ZNZIZOMTSA-N |
| XLogP | 0.60 |
| TPSA | 227.41 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.83 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|