C23H36N2O5S — CID 102590907
S-(2-acetamidoethyl) 7-[[(3R,5R)-3,5-dihydroxy-6-phenylhexanoyl]amino]heptanethioate (PubChem CID 102590907) has the molecular formula C23H36N2O5S and a molecular weight of 452.62 g/mol. Its IUPAC name is S-(2-acetamidoethyl) 7-[[(3R,5R)-3,5-dihydroxy-6-phenylhexanoyl]amino]heptanethioate.
| Compound Name | S-(2-acetamidoethyl) 7-[[(3R,5R)-3,5-dihydroxy-6-phenylhexanoyl]amino]heptanethioate |
|---|---|
| PubChem CID | 102590907 |
| Molecular Formula | C23H36N2O5S |
| Molecular Weight | 452.62 g/mol |
| Exact Mass | 452.23 |
| IUPAC Name | S-(2-acetamidoethyl) 7-[[(3R,5R)-3,5-dihydroxy-6-phenylhexanoyl]amino]heptanethioate |
| SMILES | CC(=O)NCCSC(=O)CCCCCCNC(=O)C[C@H](O)C[C@H](O)Cc1ccccc1 |
| InChI | InChI=1S/C23H36N2O5S/c1-18(26)24-13-14-31-23(30)11-7-2-3-8-12-25-22(29)17-21(28)16-20(27)15-19-9-5-4-6-10-19/h4-6,9-10,20-21,27-28H,2-3,7-8,11-17H2,1H3,(H,24,26)(H,25,29)/t20-,21-/m1/s1 |
| InChIKey | CWIXSPIQEYPECK-NHCUHLMSSA-N |
| XLogP | 2.19 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.62 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|