C22H28N4O3 — CID 102595101
(2S)-3-methyl-2-[[(2S)-3-methyl-2-(4-phenyldiazenylanilino)butanoyl]amino]butanoic acid (PubChem CID 102595101) has the molecular formula C22H28N4O3 and a molecular weight of 396.49 g/mol. Its IUPAC name is (2S)-3-methyl-2-[[(2S)-3-methyl-2-(4-phenyldiazenylanilino)butanoyl]amino]butanoic acid.
| Compound Name | (2S)-3-methyl-2-[[(2S)-3-methyl-2-(4-phenyldiazenylanilino)butanoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 102595101 |
| Molecular Formula | C22H28N4O3 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.22 |
| IUPAC Name | (2S)-3-methyl-2-[[(2S)-3-methyl-2-(4-phenyldiazenylanilino)butanoyl]amino]butanoic acid |
| SMILES | CC(C)[C@H](NC(=O)[C@@H](Nc1ccc(/N=N/c2ccccc2)cc1)C(C)C)C(=O)O |
| InChI | InChI=1S/C22H28N4O3/c1-14(2)19(21(27)24-20(15(3)4)22(28)29)23-16-10-12-18(13-11-16)26-25-17-8-6-5-7-9-17/h5-15,19-20,23H,1-4H3,(H,24,27)(H,28,29)/b26-25+/t19-,20-/m0/s1 |
| InChIKey | QJVYZCBYGQRQSY-WLNNKCLUSA-N |
| XLogP | 4.76 |
| TPSA | 103.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|