C7H7NO2 — CID 10261185
1,2,4,5-tetradeuterio-3-methoxy-6-nitrosobenzene (PubChem CID 10261185) has the molecular formula C7H7NO2 and a molecular weight of 141.16 g/mol. Its IUPAC name is 1,2,4,5-tetradeuterio-3-methoxy-6-nitrosobenzene.
| Compound Name | 1,2,4,5-tetradeuterio-3-methoxy-6-nitrosobenzene |
|---|---|
| PubChem CID | 10261185 |
| Molecular Formula | C7H7NO2 |
| Molecular Weight | 141.16 g/mol |
| Exact Mass | 141.07 |
| IUPAC Name | 1,2,4,5-tetradeuterio-3-methoxy-6-nitrosobenzene |
| SMILES | [2H]c1c([2H])c(OC)c([2H])c([2H])c1N=O |
| InChI | InChI=1S/C7H7NO2/c1-10-7-4-2-6(8-9)3-5-7/h2-5H,1H3/i2D,3D,4D,5D |
| InChIKey | RIOSDPIZGIWNMS-QFFDRWTDSA-N |
| XLogP | 2.09 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.16 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |